{ "cells": [ { "cell_type": "code", "execution_count": 1, "metadata": {}, "outputs": [], "source": [ "try:\n", " import google.colab\n", " %pip install -q ugropy\n", "except ImportError:\n", " pass" ] }, { "cell_type": "markdown", "metadata": {}, "source": [ "## Failing fragmentations\n", "\n", "[](https://colab.research.google.com/github/ipqa-research/ugropy/blob/main/docs/source/tutorial/failing_fragmentations.ipynb)\n", "\n", "`ugropy` may fail to obtain the subgroups of a molecule for a certain model for\n", "two reasons: either there is a bug in the code, or the molecule cannot be\n", "represented by the subgroups of the failing model.\n", "\n", "`ugropy` utilizes SMARTS for the representation of functional groups to inquire\n", "whether the molecule contains those structures. Let's examine the functional\n", "group list for the classic liquid-vapor UNIFAC model." ] }, { "cell_type": "code", "execution_count": 2, "metadata": {}, "outputs": [ { "data": { "text/html": [ "
| \n", " | smarts | \n", "molecular_weight | \n", "
|---|---|---|
| group | \n", "\n", " | \n", " |
| CH3 | \n", "[CX4H3] | \n", "15.03500 | \n", "
| CH2 | \n", "[CX4H2] | \n", "14.02700 | \n", "
| CH | \n", "[CX4H] | \n", "13.01900 | \n", "
| C | \n", "[CX4H0] | \n", "12.01100 | \n", "
| CH2=CH | \n", "[CH2]=[CH] | \n", "27.04600 | \n", "
| ... | \n", "... | \n", "... | \n", "
| NCO | \n", "[NX2H0]=[CX2H0]=[OX1H0] | \n", "42.01700 | \n", "
| (CH2)2SU | \n", "[CH2]S(=O)(=O)[CH2] | \n", "92.11620 | \n", "
| CH2CHSU | \n", "[CH2]S(=O)(=O)[CH] | \n", "91.10840 | \n", "
| IMIDAZOL | \n", "[c]1:[c]:[n]:[c]:[n]:1 | \n", "68.07820 | \n", "
| BTI | \n", "C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F | \n", "279.91784 | \n", "
113 rows × 2 columns
\n", "